C23H31N3O3 — CID 73437877
[4-(7-cyclopropyloxy-2H-indazol-3-yl)piperidin-1-yl]-(4-methoxycyclohexyl)methanone (PubChem CID 73437877) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is [4-(7-cyclopropyloxy-2H-indazol-3-yl)piperidin-1-yl]-(4-methoxycyclohexyl)methanone.
| Compound Name | [4-(7-cyclopropyloxy-2H-indazol-3-yl)piperidin-1-yl]-(4-methoxycyclohexyl)methanone |
|---|---|
| PubChem CID | 73437877 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | [4-(7-cyclopropyloxy-2H-indazol-3-yl)piperidin-1-yl]-(4-methoxycyclohexyl)methanone |
| SMILES | COC1CCC(C(=O)N2CCC(c3[nH]nc4c(OC5CC5)cccc34)CC2)CC1 |
| InChI | InChI=1S/C23H31N3O3/c1-28-17-7-5-16(6-8-17)23(27)26-13-11-15(12-14-26)21-19-3-2-4-20(22(19)25-24-21)29-18-9-10-18/h2-4,15-18H,5-14H2,1H3,(H,24,25) |
| InChIKey | LINYTTDRYQULMS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |