C19H24FN3O — CID 73437758
cyclohexyl-[4-(6-fluoro-2H-indazol-3-yl)piperidin-1-yl]methanone (PubChem CID 73437758) has the molecular formula C19H24FN3O and a molecular weight of 329.42 g/mol. Its IUPAC name is cyclohexyl-[4-(6-fluoro-2H-indazol-3-yl)piperidin-1-yl]methanone.
| Compound Name | cyclohexyl-[4-(6-fluoro-2H-indazol-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 73437758 |
| Molecular Formula | C19H24FN3O |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | cyclohexyl-[4-(6-fluoro-2H-indazol-3-yl)piperidin-1-yl]methanone |
| SMILES | O=C(C1CCCCC1)N1CCC(c2[nH]nc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C19H24FN3O/c20-15-6-7-16-17(12-15)21-22-18(16)13-8-10-23(11-9-13)19(24)14-4-2-1-3-5-14/h6-7,12-14H,1-5,8-11H2,(H,21,22) |
| InChIKey | DWIGIKIGEUHCAX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |