C24H28FN3O3 — CID 54432299
1-[4-[3-[4-(6-fluoro-2H-indazol-3-yl)piperidin-1-yl]propoxymethoxy]phenyl]ethanone (PubChem CID 54432299) has the molecular formula C24H28FN3O3 and a molecular weight of 425.50 g/mol. Its IUPAC name is 1-[4-[3-[4-(6-fluoro-2H-indazol-3-yl)piperidin-1-yl]propoxymethoxy]phenyl]ethanone.
| Compound Name | 1-[4-[3-[4-(6-fluoro-2H-indazol-3-yl)piperidin-1-yl]propoxymethoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 54432299 |
| Molecular Formula | C24H28FN3O3 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 1-[4-[3-[4-(6-fluoro-2H-indazol-3-yl)piperidin-1-yl]propoxymethoxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(OCOCCCN2CCC(c3[nH]nc4cc(F)ccc34)CC2)cc1 |
| InChI | InChI=1S/C24H28FN3O3/c1-17(29)18-3-6-21(7-4-18)31-16-30-14-2-11-28-12-9-19(10-13-28)24-22-8-5-20(25)15-23(22)26-27-24/h3-8,15,19H,2,9-14,16H2,1H3,(H,26,27) |
| InChIKey | WIHVDONWYFDBGU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|