C25H28FN3O4 — CID 67691156
N-[5-acetyl-2-[3-[4-(6-fluoro-2,1-benzoxazol-3-yl)piperidin-1-yl]propoxy]phenyl]acetamide (PubChem CID 67691156) has the molecular formula C25H28FN3O4 and a molecular weight of 453.51 g/mol. Its IUPAC name is N-[5-acetyl-2-[3-[4-(6-fluoro-2,1-benzoxazol-3-yl)piperidin-1-yl]propoxy]phenyl]acetamide.
| Compound Name | N-[5-acetyl-2-[3-[4-(6-fluoro-2,1-benzoxazol-3-yl)piperidin-1-yl]propoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 67691156 |
| Molecular Formula | C25H28FN3O4 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | N-[5-acetyl-2-[3-[4-(6-fluoro-2,1-benzoxazol-3-yl)piperidin-1-yl]propoxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(C(C)=O)ccc1OCCCN1CCC(c2onc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C25H28FN3O4/c1-16(30)19-4-7-24(23(14-19)27-17(2)31)32-13-3-10-29-11-8-18(9-12-29)25-21-6-5-20(26)15-22(21)28-33-25/h4-7,14-15,18H,3,8-13H2,1-2H3,(H,27,31) |
| InChIKey | FKZWHSYHIKVXAC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|