C27H34ClN3O3 — CID 174404881
1-[4-[4-[4-(6-chloro-2H-indazol-3-yl)piperidin-1-yl]butoxy]phenyl]-1-methoxybutan-2-one (PubChem CID 174404881) has the molecular formula C27H34ClN3O3 and a molecular weight of 484.04 g/mol. Its IUPAC name is 1-[4-[4-[4-(6-chloro-2H-indazol-3-yl)piperidin-1-yl]butoxy]phenyl]-1-methoxybutan-2-one.
| Compound Name | 1-[4-[4-[4-(6-chloro-2H-indazol-3-yl)piperidin-1-yl]butoxy]phenyl]-1-methoxybutan-2-one |
|---|---|
| PubChem CID | 174404881 |
| Molecular Formula | C27H34ClN3O3 |
| Molecular Weight | 484.04 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 1-[4-[4-[4-(6-chloro-2H-indazol-3-yl)piperidin-1-yl]butoxy]phenyl]-1-methoxybutan-2-one |
| SMILES | CCC(=O)C(OC)c1ccc(OCCCCN2CCC(c3[nH]nc4cc(Cl)ccc34)CC2)cc1 |
| InChI | InChI=1S/C27H34ClN3O3/c1-3-25(32)27(33-2)20-6-9-22(10-7-20)34-17-5-4-14-31-15-12-19(13-16-31)26-23-11-8-21(28)18-24(23)29-30-26/h6-11,18-19,27H,3-5,12-17H2,1-2H3,(H,29,30) |
| InChIKey | SNMYSKCWGOZMSZ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.04 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|