C23H28Cl2N2O3 — CID 153436133
N-[(4-chlorophenoxy)-[1-[3-(4-chlorophenoxy)propyl]piperidin-4-yl]methyl]acetamide (PubChem CID 153436133) has the molecular formula C23H28Cl2N2O3 and a molecular weight of 451.39 g/mol. Its IUPAC name is N-[(4-chlorophenoxy)-[1-[3-(4-chlorophenoxy)propyl]piperidin-4-yl]methyl]acetamide.
| Compound Name | N-[(4-chlorophenoxy)-[1-[3-(4-chlorophenoxy)propyl]piperidin-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 153436133 |
| Molecular Formula | C23H28Cl2N2O3 |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | N-[(4-chlorophenoxy)-[1-[3-(4-chlorophenoxy)propyl]piperidin-4-yl]methyl]acetamide |
| SMILES | CC(=O)NC(Oc1ccc(Cl)cc1)C1CCN(CCCOc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H28Cl2N2O3/c1-17(28)26-23(30-22-9-5-20(25)6-10-22)18-11-14-27(15-12-18)13-2-16-29-21-7-3-19(24)4-8-21/h3-10,18,23H,2,11-16H2,1H3,(H,26,28) |
| InChIKey | LWCJUXZDRVARDS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|