C20H30ClNO3 — CID 158514756
tert-butyl 2-[1-[3-(4-chlorophenoxy)propyl]piperidin-4-yl]acetate (PubChem CID 158514756) has the molecular formula C20H30ClNO3 and a molecular weight of 367.92 g/mol. Its IUPAC name is tert-butyl 2-[1-[3-(4-chlorophenoxy)propyl]piperidin-4-yl]acetate.
| Compound Name | tert-butyl 2-[1-[3-(4-chlorophenoxy)propyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 158514756 |
| Molecular Formula | C20H30ClNO3 |
| Molecular Weight | 367.92 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | tert-butyl 2-[1-[3-(4-chlorophenoxy)propyl]piperidin-4-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1CCN(CCCOc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H30ClNO3/c1-20(2,3)25-19(23)15-16-9-12-22(13-10-16)11-4-14-24-18-7-5-17(21)6-8-18/h5-8,16H,4,9-15H2,1-3H3 |
| InChIKey | SZXXEXRGZHYUCT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.92 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|