About N-methyl-3-pyrrolidin-2-ylpyrrolo[1,2-a]pyrazin-1-amine
N-methyl-3-pyrrolidin-2-ylpyrrolo[1,2-a]pyrazin-1-amine (PubChem CID 73439918) has the molecular formula C12H16N4
and a molecular weight of 216.29 g/mol. Its IUPAC name is N-methyl-3-pyrrolidin-2-ylpyrrolo[1,2-a]pyrazin-1-amine.
Molecular Properties
| Compound Name | N-methyl-3-pyrrolidin-2-ylpyrrolo[1,2-a]pyrazin-1-amine |
| PubChem CID | 73439918 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | N-methyl-3-pyrrolidin-2-ylpyrrolo[1,2-a]pyrazin-1-amine |
| SMILES | CNc1nc(C2CCCN2)cn2cccc12 |
| InChI | InChI=1S/C12H16N4/c1-13-12-11-5-3-7-16(11)8-10(15-12)9-4-2-6-14-9/h3,5,7-9,14H,2,4,6H2,1H3,(H,13,15) |
| InChIKey | SHZCJJVFMXHZCR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 41.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-3-pyrrolidin-2-ylpyrrolo[1,2-a]pyrazin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-pyrrolidin-2-ylpyrrolo[1,2-a]pyrazin-1-amine?
The IUPAC name of N-methyl-3-pyrrolidin-2-ylpyrrolo[1,2-a]pyrazin-1-amine (CID 73439918) is N-methyl-3-pyrrolidin-2-ylpyrrolo[1,2-a]pyrazin-1-amine.
What is the SMILES notation for N-methyl-3-pyrrolidin-2-ylpyrrolo[1,2-a]pyrazin-1-amine?
The canonical SMILES for N-methyl-3-pyrrolidin-2-ylpyrrolo[1,2-a]pyrazin-1-amine is CNc1nc(C2CCCN2)cn2cccc12.
What is the InChIKey of N-methyl-3-pyrrolidin-2-ylpyrrolo[1,2-a]pyrazin-1-amine?
The InChIKey is SHZCJJVFMXHZCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4/c1-13-12-11-5-3-7-16(11)8-10(15-12)9-4-2-6-14-9/h3,5,7-9,14H,2,4,6H2,1H3,(H,13,15).
What are the key properties of N-methyl-3-pyrrolidin-2-ylpyrrolo[1,2-a]pyrazin-1-amine?
N-methyl-3-pyrrolidin-2-ylpyrrolo[1,2-a]pyrazin-1-amine has a molecular weight of 216.29 g/mol, XLogP of 1.80, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-pyrrolidin-2-ylpyrrolo[1,2-a]pyrazin-1-amine is sourced from PubChem (CID 73439918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).