C10H18N2O — CID 73440686
1-[(3aR,8aR)-3,3a,4,5,6,7,8,8a-octahydro-2H-pyrrolo[3,2-b]azepin-1-yl]ethanone (PubChem CID 73440686) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 1-[(3aR,8aR)-3,3a,4,5,6,7,8,8a-octahydro-2H-pyrrolo[3,2-b]azepin-1-yl]ethanone.
| Compound Name | 1-[(3aR,8aR)-3,3a,4,5,6,7,8,8a-octahydro-2H-pyrrolo[3,2-b]azepin-1-yl]ethanone |
|---|---|
| PubChem CID | 73440686 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 1-[(3aR,8aR)-3,3a,4,5,6,7,8,8a-octahydro-2H-pyrrolo[3,2-b]azepin-1-yl]ethanone |
| SMILES | CC(=O)N1CC[C@H]2NCCCC[C@H]21 |
| InChI | InChI=1S/C10H18N2O/c1-8(13)12-7-5-9-10(12)4-2-3-6-11-9/h9-11H,2-7H2,1H3/t9-,10-/m1/s1 |
| InChIKey | VSEBIXJVXKKWBZ-NXEZZACHSA-N |
| XLogP | 0.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |