C27H29N3O6 — CID 73451114
ethyl 4-[[2-(2,4-dioxo-3-phenyl-4a,5a,6,7,8,9,9a,9b-octahydro-[1]benzofuro[3,2-d]pyrimidin-1-yl)acetyl]amino]benzoate (PubChem CID 73451114) has the molecular formula C27H29N3O6 and a molecular weight of 491.54 g/mol. Its IUPAC name is ethyl 4-[[2-(2,4-dioxo-3-phenyl-4a,5a,6,7,8,9,9a,9b-octahydro-[1]benzofuro[3,2-d]pyrimidin-1-yl)acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(2,4-dioxo-3-phenyl-4a,5a,6,7,8,9,9a,9b-octahydro-[1]benzofuro[3,2-d]pyrimidin-1-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 73451114 |
| Molecular Formula | C27H29N3O6 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | ethyl 4-[[2-(2,4-dioxo-3-phenyl-4a,5a,6,7,8,9,9a,9b-octahydro-[1]benzofuro[3,2-d]pyrimidin-1-yl)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN2C(=O)N(c3ccccc3)C(=O)C3OC4CCCCC4C32)cc1 |
| InChI | InChI=1S/C27H29N3O6/c1-2-35-26(33)17-12-14-18(15-13-17)28-22(31)16-29-23-20-10-6-7-11-21(20)36-24(23)25(32)30(27(29)34)19-8-4-3-5-9-19/h3-5,8-9,12-15,20-21,23-24H,2,6-7,10-11,16H2,1H3,(H,28,31) |
| InChIKey | IFMQWFDZKVDUAI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |