C19H18F3N4O4+ — CID 73451453
2-(5-ethoxy-1-methyl-2,4-dioxo-4aH-pyrido[2,3-d]pyrimidin-1-ium-3-yl)-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 73451453) has the molecular formula C19H18F3N4O4+ and a molecular weight of 423.37 g/mol. Its IUPAC name is 2-(5-ethoxy-1-methyl-2,4-dioxo-4aH-pyrido[2,3-d]pyrimidin-1-ium-3-yl)-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(5-ethoxy-1-methyl-2,4-dioxo-4aH-pyrido[2,3-d]pyrimidin-1-ium-3-yl)-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 73451453 |
| Molecular Formula | C19H18F3N4O4+ |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 2-(5-ethoxy-1-methyl-2,4-dioxo-4aH-pyrido[2,3-d]pyrimidin-1-ium-3-yl)-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCOC1=CC=NC2=[N+](C)C(=O)N(CC(=O)Nc3ccc(C(F)(F)F)cc3)C(=O)C12 |
| InChI | InChI=1S/C19H17F3N4O4/c1-3-30-13-8-9-23-16-15(13)17(28)26(18(29)25(16)2)10-14(27)24-12-6-4-11(5-7-12)19(20,21)22/h4-9,15H,3,10H2,1-2H3/p+1 |
| InChIKey | ZQTMIVWPCPTXEC-UHFFFAOYSA-O |
| XLogP | 2.27 |
| TPSA | 91.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|