C23H20BrN4O4+ — CID 73451784
N-(4-bromophenyl)-2-[3-[(4-methoxyphenyl)methyl]-2,4-dioxo-4aH-pyrido[3,2-d]pyrimidin-1-ium-1-yl]acetamide (PubChem CID 73451784) has the molecular formula C23H20BrN4O4+ and a molecular weight of 496.34 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[3-[(4-methoxyphenyl)methyl]-2,4-dioxo-4aH-pyrido[3,2-d]pyrimidin-1-ium-1-yl]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[3-[(4-methoxyphenyl)methyl]-2,4-dioxo-4aH-pyrido[3,2-d]pyrimidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 73451784 |
| Molecular Formula | C23H20BrN4O4+ |
| Molecular Weight | 496.34 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | N-(4-bromophenyl)-2-[3-[(4-methoxyphenyl)methyl]-2,4-dioxo-4aH-pyrido[3,2-d]pyrimidin-1-ium-1-yl]acetamide |
| SMILES | COc1ccc(CN2C(=O)C3N=CC=CC3=[N+](CC(=O)Nc3ccc(Br)cc3)C2=O)cc1 |
| InChI | InChI=1S/C23H19BrN4O4/c1-32-18-10-4-15(5-11-18)13-28-22(30)21-19(3-2-12-25-21)27(23(28)31)14-20(29)26-17-8-6-16(24)7-9-17/h2-12,21H,13-14H2,1H3/p+1 |
| InChIKey | WQMDEGLJTBGXIV-UHFFFAOYSA-O |
| XLogP | 3.02 |
| TPSA | 91.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|