C23H21ClN5O3+ — CID 156591730
2-[3-[(4-chlorophenyl)methyl]-2,4-dioxo-4aH-pteridin-1-ium-1-yl]-N-(2,6-dimethylphenyl)acetamide (PubChem CID 156591730) has the molecular formula C23H21ClN5O3+ and a molecular weight of 450.91 g/mol. Its IUPAC name is 2-[3-[(4-chlorophenyl)methyl]-2,4-dioxo-4aH-pteridin-1-ium-1-yl]-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-[3-[(4-chlorophenyl)methyl]-2,4-dioxo-4aH-pteridin-1-ium-1-yl]-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 156591730 |
| Molecular Formula | C23H21ClN5O3+ |
| Molecular Weight | 450.91 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 2-[3-[(4-chlorophenyl)methyl]-2,4-dioxo-4aH-pteridin-1-ium-1-yl]-N-(2,6-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)C[N+]1=C2N=CC=NC2C(=O)N(Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C23H20ClN5O3/c1-14-4-3-5-15(2)19(14)27-18(30)13-28-21-20(25-10-11-26-21)22(31)29(23(28)32)12-16-6-8-17(24)9-7-16/h3-11,20H,12-13H2,1-2H3/p+1 |
| InChIKey | AFECBJYJHZQUAQ-UHFFFAOYSA-O |
| XLogP | 2.99 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.91 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|