C21H23N5O4 — CID 73452077
3-methyl-1-(4-methylphenyl)-N-(4-nitrophenyl)-4-oxo-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 73452077) has the molecular formula C21H23N5O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is 3-methyl-1-(4-methylphenyl)-N-(4-nitrophenyl)-4-oxo-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | 3-methyl-1-(4-methylphenyl)-N-(4-nitrophenyl)-4-oxo-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 73452077 |
| Molecular Formula | C21H23N5O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 3-methyl-1-(4-methylphenyl)-N-(4-nitrophenyl)-4-oxo-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | Cc1ccc(N2NC(C)C3C(=O)C(C(=O)Nc4ccc([N+](=O)[O-])cc4)CNC32)cc1 |
| InChI | InChI=1S/C21H23N5O4/c1-12-3-7-15(8-4-12)25-20-18(13(2)24-25)19(27)17(11-22-20)21(28)23-14-5-9-16(10-6-14)26(29)30/h3-10,13,17-18,20,22,24H,11H2,1-2H3,(H,23,28) |
| InChIKey | VAJLWTBPFAQFJS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|