C18H15FN4O5 — CID 78450781
N-(4-fluoro-3-nitrophenyl)-1-(4-methylphenyl)-2,6-dioxo-1,3-diazinane-5-carboxamide (PubChem CID 78450781) has the molecular formula C18H15FN4O5 and a molecular weight of 386.34 g/mol. Its IUPAC name is N-(4-fluoro-3-nitrophenyl)-1-(4-methylphenyl)-2,6-dioxo-1,3-diazinane-5-carboxamide.
| Compound Name | N-(4-fluoro-3-nitrophenyl)-1-(4-methylphenyl)-2,6-dioxo-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 78450781 |
| Molecular Formula | C18H15FN4O5 |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | N-(4-fluoro-3-nitrophenyl)-1-(4-methylphenyl)-2,6-dioxo-1,3-diazinane-5-carboxamide |
| SMILES | Cc1ccc(N2C(=O)NCC(C(=O)Nc3ccc(F)c([N+](=O)[O-])c3)C2=O)cc1 |
| InChI | InChI=1S/C18H15FN4O5/c1-10-2-5-12(6-3-10)22-17(25)13(9-20-18(22)26)16(24)21-11-4-7-14(19)15(8-11)23(27)28/h2-8,13H,9H2,1H3,(H,20,26)(H,21,24) |
| InChIKey | YIUXMQCFHLWWRF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|