C18H12ClF4N3O3 — CID 73329476
1-(4-chlorophenyl)-N-[4-fluoro-3-(trifluoromethyl)phenyl]-2,6-dioxo-1,3-diazinane-5-carboxamide (PubChem CID 73329476) has the molecular formula C18H12ClF4N3O3 and a molecular weight of 429.76 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[4-fluoro-3-(trifluoromethyl)phenyl]-2,6-dioxo-1,3-diazinane-5-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[4-fluoro-3-(trifluoromethyl)phenyl]-2,6-dioxo-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 73329476 |
| Molecular Formula | C18H12ClF4N3O3 |
| Molecular Weight | 429.76 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[4-fluoro-3-(trifluoromethyl)phenyl]-2,6-dioxo-1,3-diazinane-5-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(C(F)(F)F)c1)C1CNC(=O)N(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C18H12ClF4N3O3/c19-9-1-4-11(5-2-9)26-16(28)12(8-24-17(26)29)15(27)25-10-3-6-14(20)13(7-10)18(21,22)23/h1-7,12H,8H2,(H,24,29)(H,25,27) |
| InChIKey | UYAMBGOMBRDCST-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.76 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|