C18H13F4N3O3 — CID 78444206
1-(4-fluorophenyl)-2,6-dioxo-N-[3-(trifluoromethyl)phenyl]-1,3-diazinane-5-carboxamide (PubChem CID 78444206) has the molecular formula C18H13F4N3O3 and a molecular weight of 395.31 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2,6-dioxo-N-[3-(trifluoromethyl)phenyl]-1,3-diazinane-5-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-2,6-dioxo-N-[3-(trifluoromethyl)phenyl]-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 78444206 |
| Molecular Formula | C18H13F4N3O3 |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 1-(4-fluorophenyl)-2,6-dioxo-N-[3-(trifluoromethyl)phenyl]-1,3-diazinane-5-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)C1CNC(=O)N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C18H13F4N3O3/c19-11-4-6-13(7-5-11)25-16(27)14(9-23-17(25)28)15(26)24-12-3-1-2-10(8-12)18(20,21)22/h1-8,14H,9H2,(H,23,28)(H,24,26) |
| InChIKey | VLPQGVDGSUHRIC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|