C18H15ClF4N2O — CID 75218836
1-(4-chlorophenyl)-N-[4-fluoro-3-(trifluoromethyl)phenyl]pyrrolidine-2-carboxamide (PubChem CID 75218836) has the molecular formula C18H15ClF4N2O and a molecular weight of 386.78 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[4-fluoro-3-(trifluoromethyl)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[4-fluoro-3-(trifluoromethyl)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 75218836 |
| Molecular Formula | C18H15ClF4N2O |
| Molecular Weight | 386.78 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[4-fluoro-3-(trifluoromethyl)phenyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(C(F)(F)F)c1)C1CCCN1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15ClF4N2O/c19-11-3-6-13(7-4-11)25-9-1-2-16(25)17(26)24-12-5-8-15(20)14(10-12)18(21,22)23/h3-8,10,16H,1-2,9H2,(H,24,26) |
| InChIKey | MTQORYQSTQPQNX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.78 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |