C21H20N4O4 — CID 73458390
1-ethyl-5-[3-(1-ethyl-6-hydroxy-5-isocyano-4-methyl-2-oxo-3-pyridinyl)prop-2-enylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 73458390) has the molecular formula C21H20N4O4 and a molecular weight of 392.42 g/mol. Its IUPAC name is 1-ethyl-5-[3-(1-ethyl-6-hydroxy-5-isocyano-4-methyl-2-oxo-3-pyridinyl)prop-2-enylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | 1-ethyl-5-[3-(1-ethyl-6-hydroxy-5-isocyano-4-methyl-2-oxo-3-pyridinyl)prop-2-enylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 73458390 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1-ethyl-5-[3-(1-ethyl-6-hydroxy-5-isocyano-4-methyl-2-oxo-3-pyridinyl)prop-2-enylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | [C-]#[N+]c1c(C)c(C=CC=C2C(=O)N(CC)C(=O)C(C#N)=C2C)c(=O)n(CC)c1O |
| InChI | InChI=1S/C21H20N4O4/c1-6-24-18(26)14(12(3)16(11-22)20(24)28)9-8-10-15-13(4)17(23-5)21(29)25(7-2)19(15)27/h8-10,29H,6-7H2,1-4H3 |
| InChIKey | CXGRVIRAYVEXOW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 107.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|