C29H36N4O4 — CID 90749934
1-butyl-5-[3-(1-butyl-6-hydroxy-5-isocyano-2-oxo-4-pentyl-3-pyridinyl)propa-1,2-dienyl]-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 90749934) has the molecular formula C29H36N4O4 and a molecular weight of 504.63 g/mol. Its IUPAC name is 1-butyl-5-[3-(1-butyl-6-hydroxy-5-isocyano-2-oxo-4-pentyl-3-pyridinyl)propa-1,2-dienyl]-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-butyl-5-[3-(1-butyl-6-hydroxy-5-isocyano-2-oxo-4-pentyl-3-pyridinyl)propa-1,2-dienyl]-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 90749934 |
| Molecular Formula | C29H36N4O4 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 1-butyl-5-[3-(1-butyl-6-hydroxy-5-isocyano-2-oxo-4-pentyl-3-pyridinyl)propa-1,2-dienyl]-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | [C-]#[N+]c1c(CCCCC)c(C=C=Cc2c(C)c(C#N)c(=O)n(CCCC)c2O)c(=O)n(CCCC)c1O |
| InChI | InChI=1S/C29H36N4O4/c1-6-9-12-14-22-23(27(35)33(18-11-8-3)29(37)25(22)31-5)16-13-15-21-20(4)24(19-30)28(36)32(26(21)34)17-10-7-2/h15-16,34,37H,6-12,14,17-18H2,1-4H3 |
| InChIKey | YMPNIOAEPLKPNM-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 112.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|