C14H18ClF3N2O2 — CID 73462293
N-[2-hydroxy-3-(propan-2-ylamino)propoxy]-3-(trifluoromethyl)benzenecarboximidoyl chloride (PubChem CID 73462293) has the molecular formula C14H18ClF3N2O2 and a molecular weight of 338.76 g/mol. Its IUPAC name is N-[2-hydroxy-3-(propan-2-ylamino)propoxy]-3-(trifluoromethyl)benzenecarboximidoyl chloride.
| Compound Name | N-[2-hydroxy-3-(propan-2-ylamino)propoxy]-3-(trifluoromethyl)benzenecarboximidoyl chloride |
|---|---|
| PubChem CID | 73462293 |
| Molecular Formula | C14H18ClF3N2O2 |
| Molecular Weight | 338.76 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | N-[2-hydroxy-3-(propan-2-ylamino)propoxy]-3-(trifluoromethyl)benzenecarboximidoyl chloride |
| SMILES | CC(C)NCC(O)CON=C(Cl)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H18ClF3N2O2/c1-9(2)19-7-12(21)8-22-20-13(15)10-4-3-5-11(6-10)14(16,17)18/h3-6,9,12,19,21H,7-8H2,1-2H3 |
| InChIKey | ITHBCNONNXQQJW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.76 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|