C16H22N2O3 — CID 7347283
(4S)-4-hydroxy-4-methyl-3-(2-methylanilino)-1-oxa-3-azaspiro[4.5]decan-2-one (PubChem CID 7347283) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is (4S)-4-hydroxy-4-methyl-3-(2-methylanilino)-1-oxa-3-azaspiro[4.5]decan-2-one.
| Compound Name | (4S)-4-hydroxy-4-methyl-3-(2-methylanilino)-1-oxa-3-azaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 7347283 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (4S)-4-hydroxy-4-methyl-3-(2-methylanilino)-1-oxa-3-azaspiro[4.5]decan-2-one |
| SMILES | Cc1ccccc1NN1C(=O)OC2(CCCCC2)[C@]1(C)O |
| InChI | InChI=1S/C16H22N2O3/c1-12-8-4-5-9-13(12)17-18-14(19)21-16(15(18,2)20)10-6-3-7-11-16/h4-5,8-9,17,20H,3,6-7,10-11H2,1-2H3/t15-/m0/s1 |
| InChIKey | VZOFKCZPGVPIHR-HNNXBMFYSA-N |
| XLogP | 3.19 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |