C17H24N2O4 — CID 7354162
(4R)-3-(2-ethoxyanilino)-4-hydroxy-4-methyl-1-oxa-3-azaspiro[4.5]decan-2-one (PubChem CID 7354162) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is (4R)-3-(2-ethoxyanilino)-4-hydroxy-4-methyl-1-oxa-3-azaspiro[4.5]decan-2-one.
| Compound Name | (4R)-3-(2-ethoxyanilino)-4-hydroxy-4-methyl-1-oxa-3-azaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 7354162 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (4R)-3-(2-ethoxyanilino)-4-hydroxy-4-methyl-1-oxa-3-azaspiro[4.5]decan-2-one |
| SMILES | CCOc1ccccc1NN1C(=O)OC2(CCCCC2)[C@@]1(C)O |
| InChI | InChI=1S/C17H24N2O4/c1-3-22-14-10-6-5-9-13(14)18-19-15(20)23-17(16(19,2)21)11-7-4-8-12-17/h5-6,9-10,18,21H,3-4,7-8,11-12H2,1-2H3/t16-/m1/s1 |
| InChIKey | SWEJOZIEYSTNFJ-MRXNPFEDSA-N |
| XLogP | 3.28 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |