C13H12BrN3O6 — CID 7348945
methyl (4S)-4-(3-bromo-2-hydroxy-5-nitrophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 7348945) has the molecular formula C13H12BrN3O6 and a molecular weight of 386.16 g/mol. Its IUPAC name is methyl (4S)-4-(3-bromo-2-hydroxy-5-nitrophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl (4S)-4-(3-bromo-2-hydroxy-5-nitrophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 7348945 |
| Molecular Formula | C13H12BrN3O6 |
| Molecular Weight | 386.16 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | methyl (4S)-4-(3-bromo-2-hydroxy-5-nitrophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)NC(=O)N[C@H]1c1cc([N+](=O)[O-])cc(Br)c1O |
| InChI | InChI=1S/C13H12BrN3O6/c1-5-9(12(19)23-2)10(16-13(20)15-5)7-3-6(17(21)22)4-8(14)11(7)18/h3-4,10,18H,1-2H3,(H2,15,16,20)/t10-/m0/s1 |
| InChIKey | XLHWGYXMPGPKGY-JTQLQIEISA-N |
| XLogP | 1.86 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.16 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|