C23H27NO3S — CID 7352062
[(2S)-1-oxo-1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propan-2-yl] 5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxylate (PubChem CID 7352062) has the molecular formula C23H27NO3S and a molecular weight of 397.54 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propan-2-yl] 5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxylate.
| Compound Name | [(2S)-1-oxo-1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propan-2-yl] 5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 7352062 |
| Molecular Formula | C23H27NO3S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | [(2S)-1-oxo-1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propan-2-yl] 5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxylate |
| SMILES | C[C@H](OC(=O)c1cc2c(s1)CCCCC2)C(=O)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C23H27NO3S/c1-15(22(25)24-19-12-7-10-16-8-5-6-11-18(16)19)27-23(26)21-14-17-9-3-2-4-13-20(17)28-21/h5-6,8,11,14-15,19H,2-4,7,9-10,12-13H2,1H3,(H,24,25)/t15-,19+/m0/s1 |
| InChIKey | OZUWIKWIQHFWII-HNAYVOBHSA-N |
| XLogP | 4.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |