C16H17N4O3+ — CID 7352897
2-[(2-methoxyphenyl)methylamino]-4,6-dimethyl-5-nitropyridin-1-ium-3-carbonitrile (PubChem CID 7352897) has the molecular formula C16H17N4O3+ and a molecular weight of 313.34 g/mol. Its IUPAC name is 2-[(2-methoxyphenyl)methylamino]-4,6-dimethyl-5-nitropyridin-1-ium-3-carbonitrile.
| Compound Name | 2-[(2-methoxyphenyl)methylamino]-4,6-dimethyl-5-nitropyridin-1-ium-3-carbonitrile |
|---|---|
| PubChem CID | 7352897 |
| Molecular Formula | C16H17N4O3+ |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2-[(2-methoxyphenyl)methylamino]-4,6-dimethyl-5-nitropyridin-1-ium-3-carbonitrile |
| SMILES | COc1ccccc1CNc1[nH+]c(C)c([N+](=O)[O-])c(C)c1C#N |
| InChI | InChI=1S/C16H16N4O3/c1-10-13(8-17)16(19-11(2)15(10)20(21)22)18-9-12-6-4-5-7-14(12)23-3/h4-7H,9H2,1-3H3,(H,18,19)/p+1 |
| InChIKey | HZMCMERYMXEIGZ-UHFFFAOYSA-O |
| XLogP | 2.52 |
| TPSA | 102.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|