C9H11N4O2+ — CID 7219368
4,6-dimethyl-2-(methylamino)-5-nitropyridin-1-ium-3-carbonitrile (PubChem CID 7219368) has the molecular formula C9H11N4O2+ and a molecular weight of 207.21 g/mol. Its IUPAC name is 4,6-dimethyl-2-(methylamino)-5-nitropyridin-1-ium-3-carbonitrile.
| Compound Name | 4,6-dimethyl-2-(methylamino)-5-nitropyridin-1-ium-3-carbonitrile |
|---|---|
| PubChem CID | 7219368 |
| Molecular Formula | C9H11N4O2+ |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 4,6-dimethyl-2-(methylamino)-5-nitropyridin-1-ium-3-carbonitrile |
| SMILES | CNc1[nH+]c(C)c([N+](=O)[O-])c(C)c1C#N |
| InChI | InChI=1S/C9H10N4O2/c1-5-7(4-10)9(11-3)12-6(2)8(5)13(14)15/h1-3H3,(H,11,12)/p+1 |
| InChIKey | OSCPQIFJZOCJIM-UHFFFAOYSA-O |
| XLogP | 0.94 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|