C8H8N4O2 — CID 54420031
6-amino-2,4-dimethyl-5-nitropyridine-3-carbonitrile (PubChem CID 54420031) has the molecular formula C8H8N4O2 and a molecular weight of 192.18 g/mol. Its IUPAC name is 6-amino-2,4-dimethyl-5-nitropyridine-3-carbonitrile.
| Compound Name | 6-amino-2,4-dimethyl-5-nitropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 54420031 |
| Molecular Formula | C8H8N4O2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 6-amino-2,4-dimethyl-5-nitropyridine-3-carbonitrile |
| SMILES | Cc1nc(N)c([N+](=O)[O-])c(C)c1C#N |
| InChI | InChI=1S/C8H8N4O2/c1-4-6(3-9)5(2)11-8(10)7(4)12(13)14/h1-2H3,(H2,10,11) |
| InChIKey | WADHDVRUUWZAIG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|