C24H31N2O2+ — CID 7353310
(2-methoxyphenyl)-[4-(1-phenylcyclohexyl)piperazin-4-ium-1-yl]methanone (PubChem CID 7353310) has the molecular formula C24H31N2O2+ and a molecular weight of 379.52 g/mol. Its IUPAC name is (2-methoxyphenyl)-[4-(1-phenylcyclohexyl)piperazin-4-ium-1-yl]methanone.
| Compound Name | (2-methoxyphenyl)-[4-(1-phenylcyclohexyl)piperazin-4-ium-1-yl]methanone |
|---|---|
| PubChem CID | 7353310 |
| Molecular Formula | C24H31N2O2+ |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | (2-methoxyphenyl)-[4-(1-phenylcyclohexyl)piperazin-4-ium-1-yl]methanone |
| SMILES | COc1ccccc1C(=O)N1CC[NH+](C2(c3ccccc3)CCCCC2)CC1 |
| InChI | InChI=1S/C24H30N2O2/c1-28-22-13-7-6-12-21(22)23(27)25-16-18-26(19-17-25)24(14-8-3-9-15-24)20-10-4-2-5-11-20/h2,4-7,10-13H,3,8-9,14-19H2,1H3/p+1 |
| InChIKey | UVYCVDGXCAMVPI-UHFFFAOYSA-O |
| XLogP | 2.90 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |