C21H25N4+ — CID 7358652
diethyl-[2-(2-phenylimidazo[1,2-a]benzimidazol-4-yl)ethyl]azanium (PubChem CID 7358652) has the molecular formula C21H25N4+ and a molecular weight of 333.46 g/mol. Its IUPAC name is diethyl-[2-(2-phenylimidazo[1,2-a]benzimidazol-4-yl)ethyl]azanium.
| Compound Name | diethyl-[2-(2-phenylimidazo[1,2-a]benzimidazol-4-yl)ethyl]azanium |
|---|---|
| PubChem CID | 7358652 |
| Molecular Formula | C21H25N4+ |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | diethyl-[2-(2-phenylimidazo[1,2-a]benzimidazol-4-yl)ethyl]azanium |
| SMILES | CC[NH+](CC)CCn1c2ccccc2n2cc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C21H24N4/c1-3-23(4-2)14-15-24-19-12-8-9-13-20(19)25-16-18(22-21(24)25)17-10-6-5-7-11-17/h5-13,16H,3-4,14-15H2,1-2H3/p+1 |
| InChIKey | HMPKOXQVGWHRCO-UHFFFAOYSA-O |
| XLogP | 2.88 |
| TPSA | 26.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |