About 2-(4-methylphenoxy)ethyl 4-bromo-3-nitrobenzoate
2-(4-methylphenoxy)ethyl 4-bromo-3-nitrobenzoate (PubChem CID 7363276) has the molecular formula C16H14BrNO5
and a molecular weight of 380.19 g/mol. Its IUPAC name is 2-(4-methylphenoxy)ethyl 4-bromo-3-nitrobenzoate.
Molecular Properties
| Compound Name | 2-(4-methylphenoxy)ethyl 4-bromo-3-nitrobenzoate |
| PubChem CID | 7363276 |
| Molecular Formula | C16H14BrNO5 |
| Molecular Weight | 380.19 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | 2-(4-methylphenoxy)ethyl 4-bromo-3-nitrobenzoate |
| SMILES | Cc1ccc(OCCOC(=O)c2ccc(Br)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C16H14BrNO5/c1-11-2-5-13(6-3-11)22-8-9-23-16(19)12-4-7-14(17)15(10-12)18(20)21/h2-7,10H,8-9H2,1H3 |
| InChIKey | DSSYYPVYHLMPEU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.19 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methylphenoxy)ethyl 4-bromo-3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenoxy)ethyl 4-bromo-3-nitrobenzoate?
The IUPAC name of 2-(4-methylphenoxy)ethyl 4-bromo-3-nitrobenzoate (CID 7363276) is 2-(4-methylphenoxy)ethyl 4-bromo-3-nitrobenzoate.
What is the SMILES notation for 2-(4-methylphenoxy)ethyl 4-bromo-3-nitrobenzoate?
The canonical SMILES for 2-(4-methylphenoxy)ethyl 4-bromo-3-nitrobenzoate is Cc1ccc(OCCOC(=O)c2ccc(Br)c([N+](=O)[O-])c2)cc1.
What is the InChIKey of 2-(4-methylphenoxy)ethyl 4-bromo-3-nitrobenzoate?
The InChIKey is DSSYYPVYHLMPEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14BrNO5/c1-11-2-5-13(6-3-11)22-8-9-23-16(19)12-4-7-14(17)15(10-12)18(20)21/h2-7,10H,8-9H2,1H3.
What are the key properties of 2-(4-methylphenoxy)ethyl 4-bromo-3-nitrobenzoate?
2-(4-methylphenoxy)ethyl 4-bromo-3-nitrobenzoate has a molecular weight of 380.19 g/mol, XLogP of 3.90, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenoxy)ethyl 4-bromo-3-nitrobenzoate is sourced from PubChem (CID 7363276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).