C8H9N3O5 — CID 7365204
2-[1-(2,4,6-trioxo-1,3-diazinan-5-yl)ethylideneamino]acetic acid (PubChem CID 7365204) has the molecular formula C8H9N3O5 and a molecular weight of 227.18 g/mol. Its IUPAC name is 2-[1-(2,4,6-trioxo-1,3-diazinan-5-yl)ethylideneamino]acetic acid.
| Compound Name | 2-[1-(2,4,6-trioxo-1,3-diazinan-5-yl)ethylideneamino]acetic acid |
|---|---|
| PubChem CID | 7365204 |
| Molecular Formula | C8H9N3O5 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 2-[1-(2,4,6-trioxo-1,3-diazinan-5-yl)ethylideneamino]acetic acid |
| SMILES | C/C(=N\CC(=O)O)C1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C8H9N3O5/c1-3(9-2-4(12)13)5-6(14)10-8(16)11-7(5)15/h5H,2H2,1H3,(H,12,13)(H2,10,11,14,15,16)/b9-3+ |
| InChIKey | XYTLLKSORCCSBW-YCRREMRBSA-N |
| XLogP | -1.49 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|