C5H4NO4S- — CID 7365266
4-oxo-1H-pyridine-3-sulfonate (PubChem CID 7365266) has the molecular formula C5H4NO4S- and a molecular weight of 174.16 g/mol. Its IUPAC name is 4-oxo-1H-pyridine-3-sulfonate.
| Compound Name | 4-oxo-1H-pyridine-3-sulfonate |
|---|---|
| PubChem CID | 7365266 |
| Molecular Formula | C5H4NO4S- |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 173.99 |
| IUPAC Name | 4-oxo-1H-pyridine-3-sulfonate |
| SMILES | O=c1cc[nH]cc1S(=O)(=O)[O-] |
| InChI | InChI=1S/C5H5NO4S/c7-4-1-2-6-3-5(4)11(8,9)10/h1-3H,(H,6,7)(H,8,9,10)/p-1 |
| InChIKey | AZRCSTMIVMQIPR-UHFFFAOYSA-M |
| XLogP | -0.72 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|