C14H15N2O2S- — CID 7366085
1-amino-5-ethyl-6,7,8,9-tetrahydrothieno[2,3-c]isoquinoline-2-carboxylate (PubChem CID 7366085) has the molecular formula C14H15N2O2S- and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-amino-5-ethyl-6,7,8,9-tetrahydrothieno[2,3-c]isoquinoline-2-carboxylate.
| Compound Name | 1-amino-5-ethyl-6,7,8,9-tetrahydrothieno[2,3-c]isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 7366085 |
| Molecular Formula | C14H15N2O2S- |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 1-amino-5-ethyl-6,7,8,9-tetrahydrothieno[2,3-c]isoquinoline-2-carboxylate |
| SMILES | CCc1nc2sc(C(=O)[O-])c(N)c2c2c1CCCC2 |
| InChI | InChI=1S/C14H16N2O2S/c1-2-9-7-5-3-4-6-8(7)10-11(15)12(14(17)18)19-13(10)16-9/h2-6,15H2,1H3,(H,17,18)/p-1 |
| InChIKey | NLKHZGNXXAIIRS-UHFFFAOYSA-M |
| XLogP | 1.68 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_acid_D(2)', 'substructure': 'N/A'} |
|---|