C13H19N5O4 — CID 7366160
2-[(3aR,6E,7aR)-6-(carbamoylhydrazinylidene)-1,3-dioxo-4,5,7,7a-tetrahydro-3aH-isoindol-2-yl]-N,N-dimethylacetamide (PubChem CID 7366160) has the molecular formula C13H19N5O4 and a molecular weight of 309.33 g/mol. Its IUPAC name is 2-[(3aR,6E,7aR)-6-(carbamoylhydrazinylidene)-1,3-dioxo-4,5,7,7a-tetrahydro-3aH-isoindol-2-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(3aR,6E,7aR)-6-(carbamoylhydrazinylidene)-1,3-dioxo-4,5,7,7a-tetrahydro-3aH-isoindol-2-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 7366160 |
| Molecular Formula | C13H19N5O4 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-[(3aR,6E,7aR)-6-(carbamoylhydrazinylidene)-1,3-dioxo-4,5,7,7a-tetrahydro-3aH-isoindol-2-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1C(=O)[C@@H]2CC/C(=N\NC(N)=O)C[C@H]2C1=O |
| InChI | InChI=1S/C13H19N5O4/c1-17(2)10(19)6-18-11(20)8-4-3-7(15-16-13(14)22)5-9(8)12(18)21/h8-9H,3-6H2,1-2H3,(H3,14,16,22)/b15-7+/t8-,9-/m1/s1 |
| InChIKey | PMPOZKGDSGRGJS-BYNQCWIMSA-N |
| XLogP | -1.12 |
| TPSA | 125.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|