C19H24ClN2O+ — CID 7366693
N-(2-chlorophenyl)-1-[(2-methoxyphenyl)methyl]piperidin-1-ium-4-amine (PubChem CID 7366693) has the molecular formula C19H24ClN2O+ and a molecular weight of 331.87 g/mol. Its IUPAC name is N-(2-chlorophenyl)-1-[(2-methoxyphenyl)methyl]piperidin-1-ium-4-amine.
| Compound Name | N-(2-chlorophenyl)-1-[(2-methoxyphenyl)methyl]piperidin-1-ium-4-amine |
|---|---|
| PubChem CID | 7366693 |
| Molecular Formula | C19H24ClN2O+ |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | N-(2-chlorophenyl)-1-[(2-methoxyphenyl)methyl]piperidin-1-ium-4-amine |
| SMILES | COc1ccccc1C[NH+]1CCC(Nc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C19H23ClN2O/c1-23-19-9-5-2-6-15(19)14-22-12-10-16(11-13-22)21-18-8-4-3-7-17(18)20/h2-9,16,21H,10-14H2,1H3/p+1 |
| InChIKey | LNQQZWAZHLMTPC-UHFFFAOYSA-O |
| XLogP | 3.01 |
| TPSA | 25.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |