C17H17Cl2NO3 — CID 7366903
6,8-dichloro-N-[(1R,2R)-2-methylcyclohexyl]-2-oxochromene-3-carboxamide (PubChem CID 7366903) has the molecular formula C17H17Cl2NO3 and a molecular weight of 354.23 g/mol. Its IUPAC name is 6,8-dichloro-N-[(1R,2R)-2-methylcyclohexyl]-2-oxochromene-3-carboxamide.
| Compound Name | 6,8-dichloro-N-[(1R,2R)-2-methylcyclohexyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 7366903 |
| Molecular Formula | C17H17Cl2NO3 |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 6,8-dichloro-N-[(1R,2R)-2-methylcyclohexyl]-2-oxochromene-3-carboxamide |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)c1cc2cc(Cl)cc(Cl)c2oc1=O |
| InChI | InChI=1S/C17H17Cl2NO3/c1-9-4-2-3-5-14(9)20-16(21)12-7-10-6-11(18)8-13(19)15(10)23-17(12)22/h6-9,14H,2-5H2,1H3,(H,20,21)/t9-,14-/m1/s1 |
| InChIKey | FUUNVOCTAHPMPJ-YMTOWFKASA-N |
| XLogP | 4.41 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|