C6H8Br2O2 — CID 737100
trans-(3S,4S)-3,4-dibromocyclopentane-1-carboxylic acid (PubChem CID 737100) has the molecular formula C6H8Br2O2 and a molecular weight of 271.94 g/mol. Its IUPAC name is trans-(3S,4S)-3,4-dibromocyclopentane-1-carboxylic acid.
| Compound Name | trans-(3S,4S)-3,4-dibromocyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 737100 |
| Molecular Formula | C6H8Br2O2 |
| Molecular Weight | 271.94 g/mol |
| Exact Mass | 269.89 |
| IUPAC Name | trans-(3S,4S)-3,4-dibromocyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1C[C@H](Br)[C@@H](Br)C1 |
| InChI | InChI=1S/C6H8Br2O2/c7-4-1-3(6(9)10)2-5(4)8/h3-5H,1-2H2,(H,9,10)/t4-,5-/m0/s1 |
| InChIKey | ASIZXNHIJAQVTG-WHFBIAKZSA-N |
| XLogP | 2.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.94 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|