About (2-chlorophenyl)thiourea
(2-chlorophenyl)thiourea (PubChem CID 737139) has the molecular formula C7H7ClN2S
and a molecular weight of 186.67 g/mol. Its IUPAC name is (2-chlorophenyl)thiourea.
Molecular Properties
| Compound Name | (2-chlorophenyl)thiourea |
| PubChem CID | 737139 |
| Molecular Formula | C7H7ClN2S |
| Molecular Weight | 186.67 g/mol |
| Exact Mass | 186.00 |
| IUPAC Name | (2-chlorophenyl)thiourea |
| SMILES | NC(=S)Nc1ccccc1Cl |
| InChI | InChI=1S/C7H7ClN2S/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) |
| InChIKey | YZUKKTCDYSIWKJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.67 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2-chlorophenyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl)thiourea?
The IUPAC name of (2-chlorophenyl)thiourea (CID 737139) is (2-chlorophenyl)thiourea.
What is the SMILES notation for (2-chlorophenyl)thiourea?
The canonical SMILES for (2-chlorophenyl)thiourea is NC(=S)Nc1ccccc1Cl.
What is the InChIKey of (2-chlorophenyl)thiourea?
The InChIKey is YZUKKTCDYSIWKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN2S/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11).
What are the key properties of (2-chlorophenyl)thiourea?
(2-chlorophenyl)thiourea has a molecular weight of 186.67 g/mol, XLogP of 2.00, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl)thiourea is sourced from PubChem (CID 737139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).