C20H19N2O3S- — CID 7371922
3-[1-[2-(4-methylanilino)-2-oxoethyl]-5-thiophen-2-ylpyrrol-2-yl]propanoate (PubChem CID 7371922) has the molecular formula C20H19N2O3S- and a molecular weight of 367.45 g/mol. Its IUPAC name is 3-[1-[2-(4-methylanilino)-2-oxoethyl]-5-thiophen-2-ylpyrrol-2-yl]propanoate.
| Compound Name | 3-[1-[2-(4-methylanilino)-2-oxoethyl]-5-thiophen-2-ylpyrrol-2-yl]propanoate |
|---|---|
| PubChem CID | 7371922 |
| Molecular Formula | C20H19N2O3S- |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 3-[1-[2-(4-methylanilino)-2-oxoethyl]-5-thiophen-2-ylpyrrol-2-yl]propanoate |
| SMILES | Cc1ccc(NC(=O)Cn2c(CCC(=O)[O-])ccc2-c2cccs2)cc1 |
| InChI | InChI=1S/C20H20N2O3S/c1-14-4-6-15(7-5-14)21-19(23)13-22-16(9-11-20(24)25)8-10-17(22)18-3-2-12-26-18/h2-8,10,12H,9,11,13H2,1H3,(H,21,23)(H,24,25)/p-1 |
| InChIKey | BODNSNQRNAWXOQ-UHFFFAOYSA-M |
| XLogP | 2.85 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'} |
|---|