C13H22N3O4+ — CID 7377770
(2S,3aS,4Z)-4-hydroxyimino-2-methyl-2-morpholin-4-ium-4-yl-1-oxido-3,5,6,7-tetrahydroindol-1-ium-3a-ol (PubChem CID 7377770) has the molecular formula C13H22N3O4+ and a molecular weight of 284.34 g/mol. Its IUPAC name is (2S,3aS,4Z)-4-hydroxyimino-2-methyl-2-morpholin-4-ium-4-yl-1-oxido-3,5,6,7-tetrahydroindol-1-ium-3a-ol.
| Compound Name | (2S,3aS,4Z)-4-hydroxyimino-2-methyl-2-morpholin-4-ium-4-yl-1-oxido-3,5,6,7-tetrahydroindol-1-ium-3a-ol |
|---|---|
| PubChem CID | 7377770 |
| Molecular Formula | C13H22N3O4+ |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (2S,3aS,4Z)-4-hydroxyimino-2-methyl-2-morpholin-4-ium-4-yl-1-oxido-3,5,6,7-tetrahydroindol-1-ium-3a-ol |
| SMILES | C[C@@]1([NH+]2CCOCC2)C[C@@]2(O)C(=[N+]1[O-])CCC/C2=N/O |
| InChI | InChI=1S/C13H21N3O4/c1-12(15-5-7-20-8-6-15)9-13(17)10(14-18)3-2-4-11(13)16(12)19/h17-18H,2-9H2,1H3/p+1/b14-10-/t12-,13-/m0/s1 |
| InChIKey | VYCFGBOIQXZVRC-ABZBSAQLSA-O |
| XLogP | -1.28 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|