C14H24N2O2 — CID 11899014
(NZ)-N-[(1S,2R,5S)-2,6,6-trimethyl-2-morpholin-4-yl-3-bicyclo[3.1.1]heptanylidene]hydroxylamine (PubChem CID 11899014) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is (NZ)-N-[(1S,2R,5S)-2,6,6-trimethyl-2-morpholin-4-yl-3-bicyclo[3.1.1]heptanylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(1S,2R,5S)-2,6,6-trimethyl-2-morpholin-4-yl-3-bicyclo[3.1.1]heptanylidene]hydroxylamine |
|---|---|
| PubChem CID | 11899014 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | (NZ)-N-[(1S,2R,5S)-2,6,6-trimethyl-2-morpholin-4-yl-3-bicyclo[3.1.1]heptanylidene]hydroxylamine |
| SMILES | CC1(C)[C@@H]2C/C(=N/O)[C@](C)(N3CCOCC3)[C@H]1C2 |
| InChI | InChI=1S/C14H24N2O2/c1-13(2)10-8-11(13)14(3,12(9-10)15-17)16-4-6-18-7-5-16/h10-11,17H,4-9H2,1-3H3/b15-12-/t10-,11-,14+/m0/s1 |
| InChIKey | CYIPWGXDQFGNCF-KXGOIHKMSA-N |
| XLogP | 1.97 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|