C17H24N2O — CID 11899018
(NZ)-N-[(1S,2R,5S)-2-(benzylamino)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]hydroxylamine (PubChem CID 11899018) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is (NZ)-N-[(1S,2R,5S)-2-(benzylamino)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(1S,2R,5S)-2-(benzylamino)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]hydroxylamine |
|---|---|
| PubChem CID | 11899018 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | (NZ)-N-[(1S,2R,5S)-2-(benzylamino)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]hydroxylamine |
| SMILES | CC1(C)[C@@H]2C/C(=N/O)[C@](C)(NCc3ccccc3)[C@H]1C2 |
| InChI | InChI=1S/C17H24N2O/c1-16(2)13-9-14(16)17(3,15(10-13)19-20)18-11-12-7-5-4-6-8-12/h4-8,13-14,18,20H,9-11H2,1-3H3/b19-15-/t13-,14-,17+/m0/s1 |
| InChIKey | NBODKULVIICHAN-NAFYFNPTSA-N |
| XLogP | 3.43 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|