About cis-(1R,2S)-N-benzyl-1-ethyl-2-phenylcyclopropan-1-amine;hydrochloride
cis-(1R,2S)-N-benzyl-1-ethyl-2-phenylcyclopropan-1-amine;hydrochloride (PubChem CID 90197726) has the molecular formula C18H22ClN
and a molecular weight of 287.83 g/mol. Its IUPAC name is cis-(1R,2S)-N-benzyl-1-ethyl-2-phenylcyclopropan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | cis-(1R,2S)-N-benzyl-1-ethyl-2-phenylcyclopropan-1-amine;hydrochloride |
| PubChem CID | 90197726 |
| Molecular Formula | C18H22ClN |
| Molecular Weight | 287.83 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | cis-(1R,2S)-N-benzyl-1-ethyl-2-phenylcyclopropan-1-amine;hydrochloride |
| SMILES | CC[C@@]1(NCc2ccccc2)C[C@H]1c1ccccc1.Cl |
| InChI | InChI=1S/C18H21N.ClH/c1-2-18(19-14-15-9-5-3-6-10-15)13-17(18)16-11-7-4-8-12-16;/h3-12,17,19H,2,13-14H2,1H3;1H/t17-,18+;/m0./s1 |
| InChIKey | YMRUXOJWWJKOQR-CJRXIRLBSA-N |
| XLogP | 4.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.83 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cis-(1R,2S)-N-benzyl-1-ethyl-2-phenylcyclopropan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2S)-N-benzyl-1-ethyl-2-phenylcyclopropan-1-amine;hydrochloride?
The IUPAC name of cis-(1R,2S)-N-benzyl-1-ethyl-2-phenylcyclopropan-1-amine;hydrochloride (CID 90197726) is cis-(1R,2S)-N-benzyl-1-ethyl-2-phenylcyclopropan-1-amine;hydrochloride.
What is the SMILES notation for cis-(1R,2S)-N-benzyl-1-ethyl-2-phenylcyclopropan-1-amine;hydrochloride?
The canonical SMILES for cis-(1R,2S)-N-benzyl-1-ethyl-2-phenylcyclopropan-1-amine;hydrochloride is CC[C@@]1(NCc2ccccc2)C[C@H]1c1ccccc1.Cl.
What is the InChIKey of cis-(1R,2S)-N-benzyl-1-ethyl-2-phenylcyclopropan-1-amine;hydrochloride?
The InChIKey is YMRUXOJWWJKOQR-CJRXIRLBSA-N. The full InChI is InChI=1S/C18H21N.ClH/c1-2-18(19-14-15-9-5-3-6-10-15)13-17(18)16-11-7-4-8-12-16;/h3-12,17,19H,2,13-14H2,1H3;1H/t17-,18+;/m0./s1.
What are the key properties of cis-(1R,2S)-N-benzyl-1-ethyl-2-phenylcyclopropan-1-amine;hydrochloride?
cis-(1R,2S)-N-benzyl-1-ethyl-2-phenylcyclopropan-1-amine;hydrochloride has a molecular weight of 287.83 g/mol, XLogP of 4.53, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-N-benzyl-1-ethyl-2-phenylcyclopropan-1-amine;hydrochloride is sourced from PubChem (CID 90197726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).