C12H27NO2 — CID 170624050
9a-methyl-1,3,4,6,7,9-hexahydro-[1,4]oxazino[3,4-c][1,4]oxazine;ethane (PubChem CID 170624050) has the molecular formula C12H27NO2 and a molecular weight of 217.35 g/mol. Its IUPAC name is 9a-methyl-1,3,4,6,7,9-hexahydro-[1,4]oxazino[3,4-c][1,4]oxazine;ethane.
| Compound Name | 9a-methyl-1,3,4,6,7,9-hexahydro-[1,4]oxazino[3,4-c][1,4]oxazine;ethane |
|---|---|
| PubChem CID | 170624050 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | 9a-methyl-1,3,4,6,7,9-hexahydro-[1,4]oxazino[3,4-c][1,4]oxazine;ethane |
| SMILES | CC.CC.CC12COCCN1CCOC2 |
| InChI | InChI=1S/C8H15NO2.2C2H6/c1-8-6-10-4-2-9(8)3-5-11-7-8;2*1-2/h2-7H2,1H3;2*1-2H3 |
| InChIKey | GSMWMUIIIWLKRY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |