C9H18N2O — CID 143189502
(9aR)-8,9a-dimethyl-1,3,4,6,7,9-hexahydropyrazino[2,1-c][1,4]oxazine (PubChem CID 143189502) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is (9aR)-8,9a-dimethyl-1,3,4,6,7,9-hexahydropyrazino[2,1-c][1,4]oxazine.
| Compound Name | (9aR)-8,9a-dimethyl-1,3,4,6,7,9-hexahydropyrazino[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 143189502 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | (9aR)-8,9a-dimethyl-1,3,4,6,7,9-hexahydropyrazino[2,1-c][1,4]oxazine |
| SMILES | CN1CCN2CCOC[C@@]2(C)C1 |
| InChI | InChI=1S/C9H18N2O/c1-9-7-10(2)3-4-11(9)5-6-12-8-9/h3-8H2,1-2H3/t9-/m1/s1 |
| InChIKey | QBRZAEKXVAQAKW-SECBINFHSA-N |
| XLogP | 0.02 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |