C19H32IN5O — CID 163742135
4-[2-iodo-6-(4,6,6-trimethyl-1,4-diazepan-1-yl)pyrimidin-4-yl]-6,6-dimethyl-1,4-oxazepane (PubChem CID 163742135) has the molecular formula C19H32IN5O and a molecular weight of 473.40 g/mol. Its IUPAC name is 4-[2-iodo-6-(4,6,6-trimethyl-1,4-diazepan-1-yl)pyrimidin-4-yl]-6,6-dimethyl-1,4-oxazepane.
| Compound Name | 4-[2-iodo-6-(4,6,6-trimethyl-1,4-diazepan-1-yl)pyrimidin-4-yl]-6,6-dimethyl-1,4-oxazepane |
|---|---|
| PubChem CID | 163742135 |
| Molecular Formula | C19H32IN5O |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 4-[2-iodo-6-(4,6,6-trimethyl-1,4-diazepan-1-yl)pyrimidin-4-yl]-6,6-dimethyl-1,4-oxazepane |
| SMILES | CN1CCN(c2cc(N3CCOCC(C)(C)C3)nc(I)n2)CC(C)(C)C1 |
| InChI | InChI=1S/C19H32IN5O/c1-18(2)11-23(5)6-7-24(12-18)15-10-16(22-17(20)21-15)25-8-9-26-14-19(3,4)13-25/h10H,6-9,11-14H2,1-5H3 |
| InChIKey | LIRFNKMGIJDONZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|