C12H20N4O — CID 143641707
4-(6,6-dimethyl-1,4-oxazepan-4-yl)-6-methylpyrimidin-2-amine (PubChem CID 143641707) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 4-(6,6-dimethyl-1,4-oxazepan-4-yl)-6-methylpyrimidin-2-amine.
| Compound Name | 4-(6,6-dimethyl-1,4-oxazepan-4-yl)-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 143641707 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 4-(6,6-dimethyl-1,4-oxazepan-4-yl)-6-methylpyrimidin-2-amine |
| SMILES | Cc1cc(N2CCOCC(C)(C)C2)nc(N)n1 |
| InChI | InChI=1S/C12H20N4O/c1-9-6-10(15-11(13)14-9)16-4-5-17-8-12(2,3)7-16/h6H,4-5,7-8H2,1-3H3,(H2,13,14,15) |
| InChIKey | HEXHGJRBVGFQKR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |