C9H16ClNO — CID 131232394
4-[(E)-3-chloroprop-2-enyl]-3,3-dimethylmorpholine (PubChem CID 131232394) has the molecular formula C9H16ClNO and a molecular weight of 189.69 g/mol. Its IUPAC name is 4-[(E)-3-chloroprop-2-enyl]-3,3-dimethylmorpholine.
| Compound Name | 4-[(E)-3-chloroprop-2-enyl]-3,3-dimethylmorpholine |
|---|---|
| PubChem CID | 131232394 |
| Molecular Formula | C9H16ClNO |
| Molecular Weight | 189.69 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 4-[(E)-3-chloroprop-2-enyl]-3,3-dimethylmorpholine |
| SMILES | CC1(C)COCCN1C/C=C/Cl |
| InChI | InChI=1S/C9H16ClNO/c1-9(2)8-12-7-6-11(9)5-3-4-10/h3-4H,5-8H2,1-2H3/b4-3+ |
| InChIKey | SCLSDJOVBIVHDY-ONEGZZNKSA-N |
| XLogP | 1.85 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.69 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |