C12H23NO3 — CID 66472303
4-[2-(1,3-dioxan-2-yl)ethyl]-3,3-dimethylmorpholine (PubChem CID 66472303) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is 4-[2-(1,3-dioxan-2-yl)ethyl]-3,3-dimethylmorpholine.
| Compound Name | 4-[2-(1,3-dioxan-2-yl)ethyl]-3,3-dimethylmorpholine |
|---|---|
| PubChem CID | 66472303 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 4-[2-(1,3-dioxan-2-yl)ethyl]-3,3-dimethylmorpholine |
| SMILES | CC1(C)COCCN1CCC1OCCCO1 |
| InChI | InChI=1S/C12H23NO3/c1-12(2)10-14-9-6-13(12)5-4-11-15-7-3-8-16-11/h11H,3-10H2,1-2H3 |
| InChIKey | OLIABZZNRYWQPP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |