About 4-[2-(1,3-dioxan-2-yl)ethyl]-3,3-dimethylmorpholine
4-[2-(1,3-dioxan-2-yl)ethyl]-3,3-dimethylmorpholine (PubChem CID 66472303) has the molecular formula C12H23NO3
and a molecular weight of 229.32 g/mol. Its IUPAC name is 4-[2-(1,3-dioxan-2-yl)ethyl]-3,3-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-[2-(1,3-dioxan-2-yl)ethyl]-3,3-dimethylmorpholine |
| PubChem CID | 66472303 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 4-[2-(1,3-dioxan-2-yl)ethyl]-3,3-dimethylmorpholine |
| SMILES | CC1(C)COCCN1CCC1OCCCO1 |
| InChI | InChI=1S/C12H23NO3/c1-12(2)10-14-9-6-13(12)5-4-11-15-7-3-8-16-11/h11H,3-10H2,1-2H3 |
| InChIKey | OLIABZZNRYWQPP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(1,3-dioxan-2-yl)ethyl]-3,3-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1,3-dioxan-2-yl)ethyl]-3,3-dimethylmorpholine?
The IUPAC name of 4-[2-(1,3-dioxan-2-yl)ethyl]-3,3-dimethylmorpholine (CID 66472303) is 4-[2-(1,3-dioxan-2-yl)ethyl]-3,3-dimethylmorpholine.
What is the SMILES notation for 4-[2-(1,3-dioxan-2-yl)ethyl]-3,3-dimethylmorpholine?
The canonical SMILES for 4-[2-(1,3-dioxan-2-yl)ethyl]-3,3-dimethylmorpholine is CC1(C)COCCN1CCC1OCCCO1.
What is the InChIKey of 4-[2-(1,3-dioxan-2-yl)ethyl]-3,3-dimethylmorpholine?
The InChIKey is OLIABZZNRYWQPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3/c1-12(2)10-14-9-6-13(12)5-4-11-15-7-3-8-16-11/h11H,3-10H2,1-2H3.
What are the key properties of 4-[2-(1,3-dioxan-2-yl)ethyl]-3,3-dimethylmorpholine?
4-[2-(1,3-dioxan-2-yl)ethyl]-3,3-dimethylmorpholine has a molecular weight of 229.32 g/mol, XLogP of 1.25, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1,3-dioxan-2-yl)ethyl]-3,3-dimethylmorpholine is sourced from PubChem (CID 66472303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).